C29H45NO4Si — CID 23834937
7-hexyl-4-methyl-1,1-di(propan-2-yl)-5-[(3,4,5-trimethoxyphenyl)methyl]-3H-oxasilolo[3,4-c]pyridine (PubChem CID 23834937) has the molecular formula C29H45NO4Si and a molecular weight of 499.77 g/mol. Its IUPAC name is 7-hexyl-4-methyl-1,1-di(propan-2-yl)-5-[(3,4,5-trimethoxyphenyl)methyl]-3H-oxasilolo[3,4-c]pyridine.
| Compound Name | 7-hexyl-4-methyl-1,1-di(propan-2-yl)-5-[(3,4,5-trimethoxyphenyl)methyl]-3H-oxasilolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 23834937 |
| Molecular Formula | C29H45NO4Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 7-hexyl-4-methyl-1,1-di(propan-2-yl)-5-[(3,4,5-trimethoxyphenyl)methyl]-3H-oxasilolo[3,4-c]pyridine |
| SMILES | CCCCCCc1nc(Cc2cc(OC)c(OC)c(OC)c2)c(C)c2c1[Si](C(C)C)(C(C)C)OC2 |
| InChI | InChI=1S/C29H45NO4Si/c1-10-11-12-13-14-24-29-23(18-34-35(29,19(2)3)20(4)5)21(6)25(30-24)15-22-16-26(31-7)28(33-9)27(17-22)32-8/h16-17,19-20H,10-15,18H2,1-9H3 |
| InChIKey | AVQNCYAHTZAPKM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|