C18H18N4O3S3 — CID 2383521
2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2383521) has the molecular formula C18H18N4O3S3 and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2383521 |
| Molecular Formula | C18H18N4O3S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccc(S(N)(=O)=O)cc2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C18H18N4O3S3/c1-10-20-17(16-13-3-2-4-14(13)27-18(16)21-10)26-9-15(23)22-11-5-7-12(8-6-11)28(19,24)25/h5-8H,2-4,9H2,1H3,(H,22,23)(H2,19,24,25) |
| InChIKey | DRTRRMUYLLQMQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |