About 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid
8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid (PubChem CID 23836154) has the molecular formula C18H32N2O3
and a molecular weight of 324.47 g/mol. Its IUPAC name is 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid.
Molecular Properties
| Compound Name | 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid |
| PubChem CID | 23836154 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid |
| SMILES | CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H32N2O3/c1-15(2)9-8-10-16(3)13-14-19-20-17(21)11-6-4-5-7-12-18(22)23/h9,14,16H,4-8,10-13H2,1-3H3,(H,20,21)(H,22,23)/b19-14+/t16-/m0/s1 |
| InChIKey | PMJGVKUGHCGTPT-TWQQJCIXSA-N |
| XLogP | 4.29 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid?
The IUPAC name of 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid (CID 23836154) is 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid.
What is the SMILES notation for 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid?
The canonical SMILES for 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid is CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCCCC(=O)O.
What is the InChIKey of 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid?
The InChIKey is PMJGVKUGHCGTPT-TWQQJCIXSA-N. The full InChI is InChI=1S/C18H32N2O3/c1-15(2)9-8-10-16(3)13-14-19-20-17(21)11-6-4-5-7-12-18(22)23/h9,14,16H,4-8,10-13H2,1-3H3,(H,20,21)(H,22,23)/b19-14+/t16-/m0/s1.
What are the key properties of 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid?
8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid has a molecular weight of 324.47 g/mol, XLogP of 4.29, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2E)-2-[(3S)-3,7-dimethyloct-6-enylidene]hydrazinyl]-8-oxooctanoic acid is sourced from PubChem (CID 23836154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).