About 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine
6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine (PubChem CID 23836200) has the molecular formula C17H23BO3
and a molecular weight of 286.18 g/mol. Its IUPAC name is 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine.
Molecular Properties
| Compound Name | 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine |
| PubChem CID | 23836200 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine |
| SMILES | C=C(COc1ccccc1)C1=CCB(O)OC1CCCC |
| InChI | InChI=1S/C17H23BO3/c1-3-4-10-17-16(11-12-18(19)21-17)14(2)13-20-15-8-6-5-7-9-15/h5-9,11,17,19H,2-4,10,12-13H2,1H3 |
| InChIKey | UKGLVIVBTIOCNV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine?
The IUPAC name of 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine (CID 23836200) is 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine.
What is the SMILES notation for 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine?
The canonical SMILES for 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine is C=C(COc1ccccc1)C1=CCB(O)OC1CCCC.
What is the InChIKey of 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine?
The InChIKey is UKGLVIVBTIOCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BO3/c1-3-4-10-17-16(11-12-18(19)21-17)14(2)13-20-15-8-6-5-7-9-15/h5-9,11,17,19H,2-4,10,12-13H2,1H3.
What are the key properties of 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine?
6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine has a molecular weight of 286.18 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinine is sourced from PubChem (CID 23836200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).