C15H19Br2NO5 — CID 23836235
(E,6R,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-6-ethoxy-N,7-dihydroxyhept-2-enamide (PubChem CID 23836235) has the molecular formula C15H19Br2NO5 and a molecular weight of 453.13 g/mol. Its IUPAC name is (E,6R,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-6-ethoxy-N,7-dihydroxyhept-2-enamide.
| Compound Name | (E,6R,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-6-ethoxy-N,7-dihydroxyhept-2-enamide |
|---|---|
| PubChem CID | 23836235 |
| Molecular Formula | C15H19Br2NO5 |
| Molecular Weight | 453.13 g/mol |
| Exact Mass | 450.96 |
| IUPAC Name | (E,6R,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-6-ethoxy-N,7-dihydroxyhept-2-enamide |
| SMILES | CCO[C@H](CC/C=C/C(=O)NO)[C@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C15H19Br2NO5/c1-2-23-12(5-3-4-6-13(19)18-22)15(21)10-7-9(16)8-11(17)14(10)20/h4,6-8,12,15,20-22H,2-3,5H2,1H3,(H,18,19)/b6-4+/t12-,15-/m1/s1 |
| InChIKey | BLMJCPWSPYYLIZ-YABQJVKDSA-N |
| XLogP | 3.20 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|