About (1R)-1-(4-hydroxyphenyl)butane-1,4-diol
(1R)-1-(4-hydroxyphenyl)butane-1,4-diol (PubChem CID 23836266) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (1R)-1-(4-hydroxyphenyl)butane-1,4-diol.
Molecular Properties
| Compound Name | (1R)-1-(4-hydroxyphenyl)butane-1,4-diol |
| PubChem CID | 23836266 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1R)-1-(4-hydroxyphenyl)butane-1,4-diol |
| SMILES | OCCC[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O3/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6,10-13H,1-2,7H2/t10-/m1/s1 |
| InChIKey | BHXJOGXPNNNGAL-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(4-hydroxyphenyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4-hydroxyphenyl)butane-1,4-diol?
The IUPAC name of (1R)-1-(4-hydroxyphenyl)butane-1,4-diol (CID 23836266) is (1R)-1-(4-hydroxyphenyl)butane-1,4-diol.
What is the SMILES notation for (1R)-1-(4-hydroxyphenyl)butane-1,4-diol?
The canonical SMILES for (1R)-1-(4-hydroxyphenyl)butane-1,4-diol is OCCC[C@@H](O)c1ccc(O)cc1.
What is the InChIKey of (1R)-1-(4-hydroxyphenyl)butane-1,4-diol?
The InChIKey is BHXJOGXPNNNGAL-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H14O3/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6,10-13H,1-2,7H2/t10-/m1/s1.
What are the key properties of (1R)-1-(4-hydroxyphenyl)butane-1,4-diol?
(1R)-1-(4-hydroxyphenyl)butane-1,4-diol has a molecular weight of 182.22 g/mol, XLogP of 1.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4-hydroxyphenyl)butane-1,4-diol is sourced from PubChem (CID 23836266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).