C21H14ClN3OS — CID 2384028
8-chloro-13-(3,4-dimethylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 2384028) has the molecular formula C21H14ClN3OS and a molecular weight of 391.88 g/mol. Its IUPAC name is 8-chloro-13-(3,4-dimethylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 8-chloro-13-(3,4-dimethylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 2384028 |
| Molecular Formula | C21H14ClN3OS |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 8-chloro-13-(3,4-dimethylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | Cc1ccc(-c2csc3nc4c5ccccc5c(Cl)nn4c(=O)c23)cc1C |
| InChI | InChI=1S/C21H14ClN3OS/c1-11-7-8-13(9-12(11)2)16-10-27-20-17(16)21(26)25-19(23-20)15-6-4-3-5-14(15)18(22)24-25/h3-10H,1-2H3 |
| InChIKey | DTLNRFLKRHZMRF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|