About 2-chloro-N,N-bis(2-phenylethyl)acetamide
2-chloro-N,N-bis(2-phenylethyl)acetamide (PubChem CID 2384236) has the molecular formula C18H20ClNO
and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N,N-bis(2-phenylethyl)acetamide |
| PubChem CID | 2384236 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-chloro-N,N-bis(2-phenylethyl)acetamide |
| SMILES | O=C(CCl)N(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO/c19-15-18(21)20(13-11-16-7-3-1-4-8-16)14-12-17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | JXPVKJHQSCSZGO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-bis(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-bis(2-phenylethyl)acetamide?
The IUPAC name of 2-chloro-N,N-bis(2-phenylethyl)acetamide (CID 2384236) is 2-chloro-N,N-bis(2-phenylethyl)acetamide.
What is the SMILES notation for 2-chloro-N,N-bis(2-phenylethyl)acetamide?
The canonical SMILES for 2-chloro-N,N-bis(2-phenylethyl)acetamide is O=C(CCl)N(CCc1ccccc1)CCc1ccccc1.
What is the InChIKey of 2-chloro-N,N-bis(2-phenylethyl)acetamide?
The InChIKey is JXPVKJHQSCSZGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClNO/c19-15-18(21)20(13-11-16-7-3-1-4-8-16)14-12-17-9-5-2-6-10-17/h1-10H,11-15H2.
What are the key properties of 2-chloro-N,N-bis(2-phenylethyl)acetamide?
2-chloro-N,N-bis(2-phenylethyl)acetamide has a molecular weight of 301.82 g/mol, XLogP of 3.54, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-bis(2-phenylethyl)acetamide is sourced from PubChem (CID 2384236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).