C28H20N2O2S — CID 2384330
2-[hydroxy-(4-methylphenyl)methylidene]-14-phenyl-12-thia-10,17-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3,5,7,11(15),13-hexaen-16-one (PubChem CID 2384330) has the molecular formula C28H20N2O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[hydroxy-(4-methylphenyl)methylidene]-14-phenyl-12-thia-10,17-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3,5,7,11(15),13-hexaen-16-one.
| Compound Name | 2-[hydroxy-(4-methylphenyl)methylidene]-14-phenyl-12-thia-10,17-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3,5,7,11(15),13-hexaen-16-one |
|---|---|
| PubChem CID | 2384330 |
| Molecular Formula | C28H20N2O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[hydroxy-(4-methylphenyl)methylidene]-14-phenyl-12-thia-10,17-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3,5,7,11(15),13-hexaen-16-one |
| SMILES | Cc1ccc(C(O)=C2c3ccccc3Cn3c2nc(=O)c2c(-c4ccccc4)csc23)cc1 |
| InChI | InChI=1S/C28H20N2O2S/c1-17-11-13-19(14-12-17)25(31)23-21-10-6-5-9-20(21)15-30-26(23)29-27(32)24-22(16-33-28(24)30)18-7-3-2-4-8-18/h2-14,16,31H,15H2,1H3 |
| InChIKey | KBMVGSJWSKHPLZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|