C29H41N3O6 — CID 23843642
(1S,2S,5R,6R,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23843642) has the molecular formula C29H41N3O6 and a molecular weight of 527.66 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (1S,2S,5R,6R,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23843642 |
| Molecular Formula | C29H41N3O6 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | (1S,2S,5R,6R,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)[C@H]1N(C(CO)CC(C)C)C(=O)[C@@H]2[C@@H](C(=O)O)[C@H]3CC[C@]21O3)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C29H41N3O6/c1-6-15-31(20-11-9-19(10-12-20)30(7-2)8-3)27(35)25-29-14-13-22(38-29)23(28(36)37)24(29)26(34)32(25)21(17-33)16-18(4)5/h6,9-12,18,21-25,33H,1,7-8,13-17H2,2-5H3,(H,36,37)/t21?,22-,23+,24+,25-,29+/m1/s1 |
| InChIKey | GZEPVBMKLRJVQU-URBMEVMPSA-N |
| XLogP | 2.92 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|