C23H32O8 — CID 23843937
[(4S)-4-acetyloxy-5-(5-acetyloxypentan-2-yl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylpropanoate (PubChem CID 23843937) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is [(4S)-4-acetyloxy-5-(5-acetyloxypentan-2-yl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylpropanoate.
| Compound Name | [(4S)-4-acetyloxy-5-(5-acetyloxypentan-2-yl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 23843937 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [(4S)-4-acetyloxy-5-(5-acetyloxypentan-2-yl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylpropanoate |
| SMILES | C=C1C(=O)OC2CC(COC(=O)C(C)C)=C(C(C)CCCOC(C)=O)[C@@H](OC(C)=O)C12 |
| InChI | InChI=1S/C23H32O8/c1-12(2)22(26)29-11-17-10-18-20(14(4)23(27)31-18)21(30-16(6)25)19(17)13(3)8-7-9-28-15(5)24/h12-13,18,20-21H,4,7-11H2,1-3,5-6H3/t13?,18?,20?,21-/m1/s1 |
| InChIKey | AAHSTEUFCXJGIV-DUBKMGCZSA-N |
| XLogP | 2.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|