C30H42O9 — CID 23843950
[(1R,2S,5R,8R,9S,10S,13R,15R)-8,15-diacetyloxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 23843950) has the molecular formula C30H42O9 and a molecular weight of 546.66 g/mol. Its IUPAC name is [(1R,2S,5R,8R,9S,10S,13R,15R)-8,15-diacetyloxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1R,2S,5R,8R,9S,10S,13R,15R)-8,15-diacetyloxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 23843950 |
| Molecular Formula | C30H42O9 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [(1R,2S,5R,8R,9S,10S,13R,15R)-8,15-diacetyloxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-2-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | C=C1[C@@H]2CC[C@H]3[C@@]4(C)C(C[C@H](OC(=O)[C@]5(C)O[C@@H]5C)[C@]3(C2)[C@@H]1OC(C)=O)[C@](C)(C(=O)OC)CC[C@H]4OC(C)=O |
| InChI | InChI=1S/C30H42O9/c1-15-19-9-10-20-28(6)21(27(5,25(33)35-8)12-11-22(28)36-17(3)31)13-23(38-26(34)29(7)16(2)39-29)30(20,14-19)24(15)37-18(4)32/h16,19-24H,1,9-14H2,2-8H3/t16-,19-,20+,21?,22-,23+,24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | OMJQQGOLDMKPAA-SDXMJAQISA-N |
| XLogP | 3.91 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|