C17H19N3O3 — CID 23844133
2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimethyl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine-5,7-dione (PubChem CID 23844133) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimethyl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine-5,7-dione.
| Compound Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimethyl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 23844133 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-4,6-dimethyl-3a,7a-dihydro-1H-imidazo[4,5-b]pyridine-5,7-dione |
| SMILES | COc1ccc(/C=C/C2=NC3C(N2)C(=O)C(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-10-15(21)14-16(20(2)17(10)22)19-13(18-14)9-6-11-4-7-12(23-3)8-5-11/h4-10,14,16H,1-3H3,(H,18,19)/b9-6+ |
| InChIKey | PMDZCIHUGXNQEU-RMKNXTFCSA-N |
| XLogP | 1.08 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|