C29H35BrN4O4Si — CID 23844318
(3R,3'R,4'S,5'R)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23844318) has the molecular formula C29H35BrN4O4Si and a molecular weight of 611.61 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23844318 |
| Molecular Formula | C29H35BrN4O4Si |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CCn3cc(C(CO)c4ccccc4)nn3)[C@@H]([Si](C)(C)O)[C@@H]2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C29H35BrN4O4Si/c1-5-14-34-25-12-11-21(30)16-23(25)29(28(34)36)19(2)27(39(3,4)37)26(38-29)13-15-33-17-24(31-32-33)22(18-35)20-9-7-6-8-10-20/h5-12,16-17,19,22,26-27,35,37H,1,13-15,18H2,2-4H3/t19-,22?,26+,27-,29+/m0/s1 |
| InChIKey | OYBOGLIEROQWBJ-AKQVZZDKSA-N |
| XLogP | 4.59 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|