C34H39N5O6Si — CID 23845612
(3S,3'S,4'R,5'S)-1-benzyl-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one (PubChem CID 23845612) has the molecular formula C34H39N5O6Si and a molecular weight of 641.80 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-1-benzyl-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-1-benzyl-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23845612 |
| Molecular Formula | C34H39N5O6Si |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | (3S,3'S,4'R,5'S)-1-benzyl-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCn3cc(CCO)nn3)O[C@@]3(C(=O)N(Cc4ccccc4)c4ccc([N+](=O)[O-])cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C34H39N5O6Si/c1-23-32(46(3,4)28-13-11-27(44-2)12-14-28)31(16-18-37-22-25(17-19-40)35-36-37)45-34(23)29-20-26(39(42)43)10-15-30(29)38(33(34)41)21-24-8-6-5-7-9-24/h5-15,20,22-23,31-32,40H,16-19,21H2,1-4H3/t23-,31+,32-,34+/m1/s1 |
| InChIKey | MXLNMJUJPINGSN-QWDHHWMXSA-N |
| XLogP | 4.58 |
| TPSA | 132.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|