C32H48N2O6Si — CID 23845965
6-ethoxy-3-(4-hydroxybutylamino)-1-[3-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 23845965) has the molecular formula C32H48N2O6Si and a molecular weight of 584.83 g/mol. Its IUPAC name is 6-ethoxy-3-(4-hydroxybutylamino)-1-[3-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-ethoxy-3-(4-hydroxybutylamino)-1-[3-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 23845965 |
| Molecular Formula | C32H48N2O6Si |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 6-ethoxy-3-(4-hydroxybutylamino)-1-[3-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | CCOc1ccc2c(c1)CC(NCCCCO)C(=O)N2c1cccc(CC[C@@H]2O[C@H](CCO)[C@@H]([Si](C)(C)O)[C@@H]2C)c1 |
| InChI | InChI=1S/C32H48N2O6Si/c1-5-39-26-12-13-28-24(20-26)21-27(33-16-6-7-17-35)32(37)34(28)25-10-8-9-23(19-25)11-14-29-22(2)31(41(3,4)38)30(40-29)15-18-36/h8-10,12-13,19-20,22,27,29-31,33,35-36,38H,5-7,11,14-18,21H2,1-4H3/t22-,27?,29+,30-,31+/m1/s1 |
| InChIKey | SSQYQEZIZQXPED-BKSIEQDNSA-N |
| XLogP | 4.32 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|