About 2-methylhexan-3-one
2-methylhexan-3-one (PubChem CID 23847) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-methylhexan-3-one.
Molecular Properties
| Compound Name | 2-methylhexan-3-one |
| PubChem CID | 23847 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 2-methylhexan-3-one |
| SMILES | CCCC(=O)C(C)C |
| InChI | InChI=1S/C7H14O/c1-4-5-7(8)6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | HIGGFWFRAWSMBR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-3-one?
The IUPAC name of 2-methylhexan-3-one (CID 23847) is 2-methylhexan-3-one.
What is the SMILES notation for 2-methylhexan-3-one?
The canonical SMILES for 2-methylhexan-3-one is CCCC(=O)C(C)C.
What is the InChIKey of 2-methylhexan-3-one?
The InChIKey is HIGGFWFRAWSMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O/c1-4-5-7(8)6(2)3/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylhexan-3-one?
2-methylhexan-3-one has a molecular weight of 114.19 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-3-one is sourced from PubChem (CID 23847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).