C17H19F3O5 — CID 23847014
(2S,4S)-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 23847014) has the molecular formula C17H19F3O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 23847014 |
| Molecular Formula | C17H19F3O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=C[C@@H](c2ccc(C(F)(F)F)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C17H19F3O5/c18-17(19,20)13-5-3-11(4-6-13)12-9-14(16(22)23)25-15(10-12)24-8-2-1-7-21/h3-6,9,12,15,21H,1-2,7-8,10H2,(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | OXRWCJDIHPEXGS-DOMZBBRYSA-N |
| XLogP | 3.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|