About (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate
(2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 23847186) has the molecular formula C26H22FNO5
and a molecular weight of 447.46 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| PubChem CID | 23847186 |
| Molecular Formula | C26H22FNO5 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)OCc3ccccc3F)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H22FNO5/c1-30-23-12-17(13-24(31-2)25(23)32-3)22-14-19(18-9-5-7-11-21(18)28-22)26(29)33-15-16-8-4-6-10-20(16)27/h4-14H,15H2,1-3H3 |
| InChIKey | ASUMNDRFHVGVIF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The IUPAC name of (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (CID 23847186) is (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
What is the SMILES notation for (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The canonical SMILES for (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate is COc1cc(-c2cc(C(=O)OCc3ccccc3F)c3ccccc3n2)cc(OC)c1OC.
What is the InChIKey of (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
The InChIKey is ASUMNDRFHVGVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22FNO5/c1-30-23-12-17(13-24(31-2)25(23)32-3)22-14-19(18-9-5-7-11-21(18)28-22)26(29)33-15-16-8-4-6-10-20(16)27/h4-14H,15H2,1-3H3.
What are the key properties of (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate?
(2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate has a molecular weight of 447.46 g/mol, XLogP of 5.42, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate is sourced from PubChem (CID 23847186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).