C20H19Cl2NO — CID 23847350
5,7-dichloro-N-methyl-N-phenyl-1,2,3,4-tetrahydroxanthen-4a-amine (PubChem CID 23847350) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is 5,7-dichloro-N-methyl-N-phenyl-1,2,3,4-tetrahydroxanthen-4a-amine.
| Compound Name | 5,7-dichloro-N-methyl-N-phenyl-1,2,3,4-tetrahydroxanthen-4a-amine |
|---|---|
| PubChem CID | 23847350 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5,7-dichloro-N-methyl-N-phenyl-1,2,3,4-tetrahydroxanthen-4a-amine |
| SMILES | CN(c1ccccc1)C12CCCCC1=Cc1cc(Cl)cc(Cl)c1O2 |
| InChI | InChI=1S/C20H19Cl2NO/c1-23(17-8-3-2-4-9-17)20-10-6-5-7-15(20)11-14-12-16(21)13-18(22)19(14)24-20/h2-4,8-9,11-13H,5-7,10H2,1H3 |
| InChIKey | GBSQFRNBICTMPU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |