C17H19FN2OS — CID 23848294
2-(3-fluorophenyl)-7-methyl-2,3,4a,5,6,7,8,9a-octahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23848294) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-7-methyl-2,3,4a,5,6,7,8,9a-octahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-fluorophenyl)-7-methyl-2,3,4a,5,6,7,8,9a-octahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23848294 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(3-fluorophenyl)-7-methyl-2,3,4a,5,6,7,8,9a-octahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCC2=C(C1)SC1NC(c3cccc(F)c3)NC(=O)C21 |
| InChI | InChI=1S/C17H19FN2OS/c1-9-5-6-12-13(7-9)22-17-14(12)16(21)19-15(20-17)10-3-2-4-11(18)8-10/h2-4,8-9,14-15,17,20H,5-7H2,1H3,(H,19,21) |
| InChIKey | NMCHPNAVHYDDON-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |