About 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol
4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol (PubChem CID 2384881) has the molecular formula C20H14F3N3O2S
and a molecular weight of 417.41 g/mol. Its IUPAC name is 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol |
| PubChem CID | 2384881 |
| Molecular Formula | C20H14F3N3O2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol |
| SMILES | Cc1nc(-c2c(C(F)(F)F)nn(-c3ccccc3)c2-c2ccc(O)cc2O)cs1 |
| InChI | InChI=1S/C20H14F3N3O2S/c1-11-24-15(10-29-11)17-18(14-8-7-13(27)9-16(14)28)26(12-5-3-2-4-6-12)25-19(17)20(21,22)23/h2-10,27-28H,1H3 |
| InChIKey | TXZQYZDRVCPCSR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol?
The IUPAC name of 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol (CID 2384881) is 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol.
What is the SMILES notation for 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol?
The canonical SMILES for 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol is Cc1nc(-c2c(C(F)(F)F)nn(-c3ccccc3)c2-c2ccc(O)cc2O)cs1.
What is the InChIKey of 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol?
The InChIKey is TXZQYZDRVCPCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3O2S/c1-11-24-15(10-29-11)17-18(14-8-7-13(27)9-16(14)28)26(12-5-3-2-4-6-12)25-19(17)20(21,22)23/h2-10,27-28H,1H3.
What are the key properties of 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol?
4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol has a molecular weight of 417.41 g/mol, XLogP of 5.40, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-methyl-1,3-thiazol-4-yl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzene-1,3-diol is sourced from PubChem (CID 2384881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).