About 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine
10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine (PubChem CID 23849194) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine.
Molecular Properties
| Compound Name | 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine |
| PubChem CID | 23849194 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine |
| SMILES | COc1cc(C(C)C)cc2c1-c1cnccc1C(C)(C)O2 |
| InChI | InChI=1S/C18H21NO2/c1-11(2)12-8-15(20-5)17-13-10-19-7-6-14(13)18(3,4)21-16(17)9-12/h6-11H,1-5H3 |
| InChIKey | INYMUYDLTSVSPG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine?
The IUPAC name of 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine (CID 23849194) is 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine.
What is the SMILES notation for 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine?
The canonical SMILES for 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine is COc1cc(C(C)C)cc2c1-c1cnccc1C(C)(C)O2.
What is the InChIKey of 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine?
The InChIKey is INYMUYDLTSVSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-11(2)12-8-15(20-5)17-13-10-19-7-6-14(13)18(3,4)21-16(17)9-12/h6-11H,1-5H3.
What are the key properties of 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine?
10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine has a molecular weight of 283.37 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-5,5-dimethyl-8-propan-2-ylchromeno[4,3-c]pyridine is sourced from PubChem (CID 23849194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).