About 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine
4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine (PubChem CID 23849629) has the molecular formula C9H10BrN5O
and a molecular weight of 284.12 g/mol. Its IUPAC name is 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine |
| PubChem CID | 23849629 |
| Molecular Formula | C9H10BrN5O |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine |
| SMILES | Brc1nnc2ccc(N3CCOCC3)nn12 |
| InChI | InChI=1S/C9H10BrN5O/c10-9-12-11-7-1-2-8(13-15(7)9)14-3-5-16-6-4-14/h1-2H,3-6H2 |
| InChIKey | NJQNIZBTRYOUJS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine?
The IUPAC name of 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine (CID 23849629) is 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine.
What is the SMILES notation for 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine?
The canonical SMILES for 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine is Brc1nnc2ccc(N3CCOCC3)nn12.
What is the InChIKey of 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine?
The InChIKey is NJQNIZBTRYOUJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN5O/c10-9-12-11-7-1-2-8(13-15(7)9)14-3-5-16-6-4-14/h1-2H,3-6H2.
What are the key properties of 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine?
4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine has a molecular weight of 284.12 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)morpholine is sourced from PubChem (CID 23849629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).