About 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine
3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine (PubChem CID 23849634) has the molecular formula C17H20F2N2S
and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine |
| PubChem CID | 23849634 |
| Molecular Formula | C17H20F2N2S |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(F)cc2F)n1C1CCCCCC1 |
| InChI | InChI=1S/C17H20F2N2S/c1-12-11-22-17(20-16-9-8-13(18)10-15(16)19)21(12)14-6-4-2-3-5-7-14/h8-11,14H,2-7H2,1H3/b20-17- |
| InChIKey | PDBZFWNHNQEQOK-JZJYNLBNSA-N |
| XLogP | 5.26 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine?
The IUPAC name of 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine (CID 23849634) is 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine.
What is the SMILES notation for 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine?
The canonical SMILES for 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine is Cc1cs/c(=N\c2ccc(F)cc2F)n1C1CCCCCC1.
What is the InChIKey of 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine?
The InChIKey is PDBZFWNHNQEQOK-JZJYNLBNSA-N. The full InChI is InChI=1S/C17H20F2N2S/c1-12-11-22-17(20-16-9-8-13(18)10-15(16)19)21(12)14-6-4-2-3-5-7-14/h8-11,14H,2-7H2,1H3/b20-17-.
What are the key properties of 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine?
3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine has a molecular weight of 322.42 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyl-N-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-2-imine is sourced from PubChem (CID 23849634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).