C19H22ClN3O — CID 23849763
4-(2-chlorophenyl)-N-(2,6-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 23849763) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(2,6-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-chlorophenyl)-N-(2,6-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23849763 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(2,6-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H22ClN3O/c1-14-6-5-7-15(2)18(14)21-19(24)23-12-10-22(11-13-23)17-9-4-3-8-16(17)20/h3-9H,10-13H2,1-2H3,(H,21,24) |
| InChIKey | AHAJWBRWWKHEHG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |