About 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid
3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 23849767) has the molecular formula C24H16N2O4S
and a molecular weight of 428.47 g/mol. Its IUPAC name is 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid |
| PubChem CID | 23849767 |
| Molecular Formula | C24H16N2O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccccc2C=c2sc3nc4ccccc4n3c2=O)c1 |
| InChI | InChI=1S/C24H16N2O4S/c27-22-21(31-24-25-18-9-2-3-10-19(18)26(22)24)13-16-7-1-4-11-20(16)30-14-15-6-5-8-17(12-15)23(28)29/h1-13H,14H2,(H,28,29) |
| InChIKey | PPOFRYUQNUQRNU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid?
The IUPAC name of 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid (CID 23849767) is 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid.
What is the SMILES notation for 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid?
The canonical SMILES for 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid is O=C(O)c1cccc(COc2ccccc2C=c2sc3nc4ccccc4n3c2=O)c1.
What is the InChIKey of 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid?
The InChIKey is PPOFRYUQNUQRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2O4S/c27-22-21(31-24-25-18-9-2-3-10-19(18)26(22)24)13-16-7-1-4-11-20(16)30-14-15-6-5-8-17(12-15)23(28)29/h1-13H,14H2,(H,28,29).
What are the key properties of 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid?
3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid has a molecular weight of 428.47 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenoxy]methyl]benzoic acid is sourced from PubChem (CID 23849767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).