About (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate
(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate (PubChem CID 23849844) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate.
Molecular Properties
| Compound Name | (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate |
| PubChem CID | 23849844 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate |
| SMILES | Cc1cccc2c1OC(COC(N)=O)CO2 |
| InChI | InChI=1S/C11H13NO4/c1-7-3-2-4-9-10(7)16-8(5-14-9)6-15-11(12)13/h2-4,8H,5-6H2,1H3,(H2,12,13) |
| InChIKey | FCGLZNWZOBLPFH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate?
The IUPAC name of (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate (CID 23849844) is (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate.
What is the SMILES notation for (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate?
The canonical SMILES for (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate is Cc1cccc2c1OC(COC(N)=O)CO2.
What is the InChIKey of (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate?
The InChIKey is FCGLZNWZOBLPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-7-3-2-4-9-10(7)16-8(5-14-9)6-15-11(12)13/h2-4,8H,5-6H2,1H3,(H2,12,13).
What are the key properties of (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate?
(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate has a molecular weight of 223.23 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl carbamate is sourced from PubChem (CID 23849844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).