C21H26N4O2 — CID 23851243
N-[(2S)-3-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)butan-2-yl]benzamide (PubChem CID 23851243) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)butan-2-yl]benzamide.
| Compound Name | N-[(2S)-3-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 23851243 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)butan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1)C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H26N4O2/c1-16(2)19(23-20(26)17-8-4-3-5-9-17)21(27)25-14-12-24(13-15-25)18-10-6-7-11-22-18/h3-11,16,19H,12-15H2,1-2H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | BSYLNELWMKSUKK-IBGZPJMESA-N |
| XLogP | 2.18 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |