C25H27N3O2S — CID 23851429
6-[3-(2-methylcyclohexyl)-2-(3-methylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23851429) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 6-[3-(2-methylcyclohexyl)-2-(3-methylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(2-methylcyclohexyl)-2-(3-methylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23851429 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 6-[3-(2-methylcyclohexyl)-2-(3-methylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2C2CCCCC2C)c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-16-6-5-8-19(12-16)26-25-28(21-9-4-3-7-17(21)2)22(15-31-25)18-10-11-23-20(13-18)27-24(29)14-30-23/h5-6,8,10-13,15,17,21H,3-4,7,9,14H2,1-2H3,(H,27,29)/b26-25- |
| InChIKey | CASHXDOCDLYBIS-QPLCGJKRSA-N |
| XLogP | 5.84 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|