C26H27N3O4 — CID 23851544
2-(cyclopentanecarbonyl)-1-(4-methylphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide (PubChem CID 23851544) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-(cyclopentanecarbonyl)-1-(4-methylphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide.
| Compound Name | 2-(cyclopentanecarbonyl)-1-(4-methylphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 23851544 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-(cyclopentanecarbonyl)-1-(4-methylphenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxamide |
| SMILES | Cc1ccc(C2C3C(=O)N(c4ccccc4)C(=O)C3C(C(N)=O)N2C(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-15-11-13-16(14-12-15)21-19-20(26(33)28(25(19)32)18-9-3-2-4-10-18)22(23(27)30)29(21)24(31)17-7-5-6-8-17/h2-4,9-14,17,19-22H,5-8H2,1H3,(H2,27,30) |
| InChIKey | DKTIZIIPSHDAAZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|