C14H8N4O4S — CID 23852161
methyl 7,9-dioxo-17-thia-2,4,8,10-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,11,13,15-hexaene-5-carboxylate (PubChem CID 23852161) has the molecular formula C14H8N4O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is methyl 7,9-dioxo-17-thia-2,4,8,10-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,11,13,15-hexaene-5-carboxylate.
| Compound Name | methyl 7,9-dioxo-17-thia-2,4,8,10-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,11,13,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 23852161 |
| Molecular Formula | C14H8N4O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | methyl 7,9-dioxo-17-thia-2,4,8,10-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,11,13,15-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cc(=O)n2c(=O)n3c(nc2n1)sc1ccccc13 |
| InChI | InChI=1S/C14H8N4O4S/c1-22-11(20)7-6-10(19)18-12(15-7)16-13-17(14(18)21)8-4-2-3-5-9(8)23-13/h2-6H,1H3 |
| InChIKey | GDCXFDNLFNGELN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |