C29H29N5O5 — CID 23852395
N-(2-aminocyclohexyl)-1-(4-nitrobenzoyl)-4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide (PubChem CID 23852395) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-1-(4-nitrobenzoyl)-4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide.
| Compound Name | N-(2-aminocyclohexyl)-1-(4-nitrobenzoyl)-4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide |
|---|---|
| PubChem CID | 23852395 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-(2-aminocyclohexyl)-1-(4-nitrobenzoyl)-4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide |
| SMILES | NC1CCCCC1NC(=O)c1ccc2c(c1)NC(=O)CC(c1ccccc1)N2C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H29N5O5/c30-22-8-4-5-9-23(22)32-28(36)20-12-15-25-24(16-20)31-27(35)17-26(18-6-2-1-3-7-18)33(25)29(37)19-10-13-21(14-11-19)34(38)39/h1-3,6-7,10-16,22-23,26H,4-5,8-9,17,30H2,(H,31,35)(H,32,36) |
| InChIKey | XEIFEIUCXLNNQE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|