About [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate
[2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 2385257) has the molecular formula C26H24N2O3S
and a molecular weight of 444.56 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| PubChem CID | 2385257 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H24N2O3S/c1-3-17-10-9-11-18(4-2)24(17)28-23(29)16-31-26(30)20-13-6-5-12-19(20)25-27-21-14-7-8-15-22(21)32-25/h5-15H,3-4,16H2,1-2H3,(H,28,29) |
| InChIKey | SWMYCWBVTBITJA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The IUPAC name of [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (CID 2385257) is [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
What is the SMILES notation for [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The canonical SMILES for [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate is CCc1cccc(CC)c1NC(=O)COC(=O)c1ccccc1-c1nc2ccccc2s1.
What is the InChIKey of [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The InChIKey is SWMYCWBVTBITJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O3S/c1-3-17-10-9-11-18(4-2)24(17)28-23(29)16-31-26(30)20-13-6-5-12-19(20)25-27-21-14-7-8-15-22(21)32-25/h5-15H,3-4,16H2,1-2H3,(H,28,29).
What are the key properties of [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
[2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate has a molecular weight of 444.56 g/mol, XLogP of 5.88, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-diethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate is sourced from PubChem (CID 2385257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).