C29H23N3O9S — CID 23853971
[4-[(3-nitrobenzoyl)-(2,4,5-trimethylphenyl)sulfonylamino]phenyl] 3-nitrobenzoate (PubChem CID 23853971) has the molecular formula C29H23N3O9S and a molecular weight of 589.58 g/mol. Its IUPAC name is [4-[(3-nitrobenzoyl)-(2,4,5-trimethylphenyl)sulfonylamino]phenyl] 3-nitrobenzoate.
| Compound Name | [4-[(3-nitrobenzoyl)-(2,4,5-trimethylphenyl)sulfonylamino]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 23853971 |
| Molecular Formula | C29H23N3O9S |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | [4-[(3-nitrobenzoyl)-(2,4,5-trimethylphenyl)sulfonylamino]phenyl] 3-nitrobenzoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C(=O)c2cccc([N+](=O)[O-])c2)c2ccc(OC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1C |
| InChI | InChI=1S/C29H23N3O9S/c1-18-14-20(3)27(15-19(18)2)42(39,40)30(28(33)21-6-4-8-24(16-21)31(35)36)23-10-12-26(13-11-23)41-29(34)22-7-5-9-25(17-22)32(37)38/h4-17H,1-3H3 |
| InChIKey | ZUTLDTLFIVJMKO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|