C24H19ClN2O4 — CID 23855524
1-(4-chlorophenyl)-2,5-dioxo-N-phenacyl-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 23855524) has the molecular formula C24H19ClN2O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dioxo-N-phenacyl-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dioxo-N-phenacyl-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 23855524 |
| Molecular Formula | C24H19ClN2O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dioxo-N-phenacyl-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | O=C(CNC(=O)c1cc2c(n(-c3ccc(Cl)cc3)c1=O)CCCC2=O)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O4/c25-16-9-11-17(12-10-16)27-20-7-4-8-21(28)18(20)13-19(24(27)31)23(30)26-14-22(29)15-5-2-1-3-6-15/h1-3,5-6,9-13H,4,7-8,14H2,(H,26,30) |
| InChIKey | NHMUUHYUHFMMCR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |