C28H24N4O4S — CID 23855967
5-cyano-6-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2-methyl-N-(2-methylphenyl)-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxamide (PubChem CID 23855967) has the molecular formula C28H24N4O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is 5-cyano-6-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2-methyl-N-(2-methylphenyl)-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxamide.
| Compound Name | 5-cyano-6-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2-methyl-N-(2-methylphenyl)-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 23855967 |
| Molecular Formula | C28H24N4O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 5-cyano-6-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2-methyl-N-(2-methylphenyl)-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2C)C(c2cccnc2)C(C#N)=C(SCC(=O)c2ccc(O)c(O)c2)N1 |
| InChI | InChI=1S/C28H24N4O4S/c1-16-6-3-4-8-21(16)32-27(36)25-17(2)31-28(20(13-29)26(25)19-7-5-11-30-14-19)37-15-24(35)18-9-10-22(33)23(34)12-18/h3-12,14,26,31,33-34H,15H2,1-2H3,(H,32,36) |
| InChIKey | MTDICKHICHWTBX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|