C21H21N3O2 — CID 23855993
cyclohexyl 4-(quinazolin-4-ylamino)benzoate (PubChem CID 23855993) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is cyclohexyl 4-(quinazolin-4-ylamino)benzoate.
| Compound Name | cyclohexyl 4-(quinazolin-4-ylamino)benzoate |
|---|---|
| PubChem CID | 23855993 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | cyclohexyl 4-(quinazolin-4-ylamino)benzoate |
| SMILES | O=C(OC1CCCCC1)c1ccc(Nc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C21H21N3O2/c25-21(26-17-6-2-1-3-7-17)15-10-12-16(13-11-15)24-20-18-8-4-5-9-19(18)22-14-23-20/h4-5,8-14,17H,1-3,6-7H2,(H,22,23,24) |
| InChIKey | HTDYXISNCSHRTK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |