About 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one
4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 23856369) has the molecular formula C22H22F2N2O
and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one.
Molecular Properties
| Compound Name | 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one |
| PubChem CID | 23856369 |
| Molecular Formula | C22H22F2N2O |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | Cn1c2c(c3cc(F)ccc31)CN(CCCC(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H22F2N2O/c1-25-20-9-8-17(24)13-18(20)19-14-26(12-10-21(19)25)11-2-3-22(27)15-4-6-16(23)7-5-15/h4-9,13H,2-3,10-12,14H2,1H3 |
| InChIKey | RYAPDEMZJREJTM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one?
The IUPAC name of 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one (CID 23856369) is 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one.
What is the SMILES notation for 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one?
The canonical SMILES for 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one is Cn1c2c(c3cc(F)ccc31)CN(CCCC(=O)c1ccc(F)cc1)CC2.
What is the InChIKey of 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one?
The InChIKey is RYAPDEMZJREJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2N2O/c1-25-20-9-8-17(24)13-18(20)19-14-26(12-10-21(19)25)11-2-3-22(27)15-4-6-16(23)7-5-15/h4-9,13H,2-3,10-12,14H2,1H3.
What are the key properties of 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one?
4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one has a molecular weight of 368.43 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-1-(4-fluorophenyl)butan-1-one is sourced from PubChem (CID 23856369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).