C17H14N4O2S2 — CID 23856518
[4-[[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]phenyl] thiocyanate (PubChem CID 23856518) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is [4-[[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 23856518 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [4-[[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]phenyl] thiocyanate |
| SMILES | COc1ccc2nc(SCC(=O)Nc3ccc(SC#N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C17H14N4O2S2/c1-23-12-4-7-14-15(8-12)21-17(20-14)24-9-16(22)19-11-2-5-13(6-3-11)25-10-18/h2-8H,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | DZSAVGPKTVBXDK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|