About 4-methoxy-2,6-dimethyl-8H-pteridin-7-one
4-methoxy-2,6-dimethyl-8H-pteridin-7-one (PubChem CID 23857055) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-8H-pteridin-7-one.
Molecular Properties
| Compound Name | 4-methoxy-2,6-dimethyl-8H-pteridin-7-one |
| PubChem CID | 23857055 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-8H-pteridin-7-one |
| SMILES | COc1nc(C)nc2[nH]c(=O)c(C)nc12 |
| InChI | InChI=1S/C9H10N4O2/c1-4-8(14)13-7-6(10-4)9(15-3)12-5(2)11-7/h1-3H3,(H,11,12,13,14) |
| InChIKey | NELUJCBNTLAMCL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-2,6-dimethyl-8H-pteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,6-dimethyl-8H-pteridin-7-one?
The IUPAC name of 4-methoxy-2,6-dimethyl-8H-pteridin-7-one (CID 23857055) is 4-methoxy-2,6-dimethyl-8H-pteridin-7-one.
What is the SMILES notation for 4-methoxy-2,6-dimethyl-8H-pteridin-7-one?
The canonical SMILES for 4-methoxy-2,6-dimethyl-8H-pteridin-7-one is COc1nc(C)nc2[nH]c(=O)c(C)nc12.
What is the InChIKey of 4-methoxy-2,6-dimethyl-8H-pteridin-7-one?
The InChIKey is NELUJCBNTLAMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-4-8(14)13-7-6(10-4)9(15-3)12-5(2)11-7/h1-3H3,(H,11,12,13,14).
What are the key properties of 4-methoxy-2,6-dimethyl-8H-pteridin-7-one?
4-methoxy-2,6-dimethyl-8H-pteridin-7-one has a molecular weight of 206.20 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,6-dimethyl-8H-pteridin-7-one is sourced from PubChem (CID 23857055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).