C20H18Cl2N2OS2 — CID 23857208
2-(2,4-dichlorophenyl)-7-ethoxy-4,4-dimethyl-5H-[1,2]thiazolo[5,4-c]quinoline-1-thione (PubChem CID 23857208) has the molecular formula C20H18Cl2N2OS2 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-7-ethoxy-4,4-dimethyl-5H-[1,2]thiazolo[5,4-c]quinoline-1-thione.
| Compound Name | 2-(2,4-dichlorophenyl)-7-ethoxy-4,4-dimethyl-5H-[1,2]thiazolo[5,4-c]quinoline-1-thione |
|---|---|
| PubChem CID | 23857208 |
| Molecular Formula | C20H18Cl2N2OS2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-7-ethoxy-4,4-dimethyl-5H-[1,2]thiazolo[5,4-c]quinoline-1-thione |
| SMILES | CCOc1ccc2c(c1)NC(C)(C)c1sn(-c3ccc(Cl)cc3Cl)c(=S)c1-2 |
| InChI | InChI=1S/C20H18Cl2N2OS2/c1-4-25-12-6-7-13-15(10-12)23-20(2,3)18-17(13)19(26)24(27-18)16-8-5-11(21)9-14(16)22/h5-10,23H,4H2,1-3H3 |
| InChIKey | IZIRQYMSRDZTDD-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_65A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|