C23H21IN2O3 — CID 23857693
[2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23857693) has the molecular formula C23H21IN2O3 and a molecular weight of 500.34 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23857693 |
| Molecular Formula | C23H21IN2O3 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC1CCc2nc3ccccc3c(C(=O)OCC(=O)Nc3ccc(I)cc3)c2C1 |
| InChI | InChI=1S/C23H21IN2O3/c1-14-6-11-20-18(12-14)22(17-4-2-3-5-19(17)26-20)23(28)29-13-21(27)25-16-9-7-15(24)8-10-16/h2-5,7-10,14H,6,11-13H2,1H3,(H,25,27) |
| InChIKey | QSCYTXLSKTYNOU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|