C22H26N2O3 — CID 23857787
7'-hydroxy-4,4,5'-trimethyl-4'-(2-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one (PubChem CID 23857787) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 7'-hydroxy-4,4,5'-trimethyl-4'-(2-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one.
| Compound Name | 7'-hydroxy-4,4,5'-trimethyl-4'-(2-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one |
|---|---|
| PubChem CID | 23857787 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 7'-hydroxy-4,4,5'-trimethyl-4'-(2-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one |
| SMILES | Cc1ccccc1C1CC2(CC(C)(C)NC(=O)N2)Oc2cc(O)cc(C)c21 |
| InChI | InChI=1S/C22H26N2O3/c1-13-7-5-6-8-16(13)17-11-22(12-21(3,4)23-20(26)24-22)27-18-10-15(25)9-14(2)19(17)18/h5-10,17,25H,11-12H2,1-4H3,(H2,23,24,26) |
| InChIKey | JBBAGJHZMHGDBU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |