About 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate
1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 2385812) has the molecular formula C20H27NO5
and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 2385812 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CCc1ccc(C(=O)COC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27NO5/c1-5-14-8-10-15(11-9-14)17(22)13-25-18(23)16-7-6-12-21(16)19(24)26-20(2,3)4/h8-11,16H,5-7,12-13H2,1-4H3/t16-/m0/s1 |
| InChIKey | XDRCKXBILXDALT-INIZCTEOSA-N |
| XLogP | 3.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate (CID 2385812) is 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate is CCc1ccc(C(=O)COC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1.
What is the InChIKey of 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The InChIKey is XDRCKXBILXDALT-INIZCTEOSA-N. The full InChI is InChI=1S/C20H27NO5/c1-5-14-8-10-15(11-9-14)17(22)13-25-18(23)16-7-6-12-21(16)19(24)26-20(2,3)4/h8-11,16H,5-7,12-13H2,1-4H3/t16-/m0/s1.
What are the key properties of 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate has a molecular weight of 361.44 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-[2-(4-ethylphenyl)-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 2385812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).