C21H17N5O3S2 — CID 23858471
3-amino-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23858471) has the molecular formula C21H17N5O3S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-amino-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23858471 |
| Molecular Formula | C21H17N5O3S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-amino-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)sc2nc3c(cc12)CCCC3 |
| InChI | InChI=1S/C21H17N5O3S2/c22-17-14-9-12-4-1-2-7-15(12)23-20(14)31-18(17)19(27)25-21-24-16(10-30-21)11-5-3-6-13(8-11)26(28)29/h3,5-6,8-10H,1-2,4,7,22H2,(H,24,25,27) |
| InChIKey | YLNGDMPZWIPFMN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|