C16H19F4NOS — CID 23858547
2-cyclohexylsulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide (PubChem CID 23858547) has the molecular formula C16H19F4NOS and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide.
| Compound Name | 2-cyclohexylsulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide |
|---|---|
| PubChem CID | 23858547 |
| Molecular Formula | C16H19F4NOS |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide |
| SMILES | CCC(SC1CCCCC1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H19F4NOS/c1-2-12(23-9-6-4-3-5-7-9)16(22)21-15-13(19)10(17)8-11(18)14(15)20/h8-9,12H,2-7H2,1H3,(H,21,22) |
| InChIKey | SYVSYMAOQRKNQA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|