C12H11N4O3S- — CID 2385860
3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 2385860) has the molecular formula C12H11N4O3S- and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | 3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2385860 |
| Molecular Formula | C12H11N4O3S- |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | Cn1cnnc1SCC(=O)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C12H12N4O3S/c1-16-7-13-15-12(16)20-6-10(17)14-9-4-2-3-8(5-9)11(18)19/h2-5,7H,6H2,1H3,(H,14,17)(H,18,19)/p-1 |
| InChIKey | RDOYILDEAZBWGZ-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |