C12H10F4N2OS2 — CID 23858692
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 23858692) has the molecular formula C12H10F4N2OS2 and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 23858692 |
| Molecular Formula | C12H10F4N2OS2 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | CC(SC1=NCCS1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H10F4N2OS2/c1-5(21-12-17-2-3-20-12)11(19)18-10-8(15)6(13)4-7(14)9(10)16/h4-5H,2-3H2,1H3,(H,18,19) |
| InChIKey | XRDOQJOUWYXELF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|