C31H26N4OS — CID 23859713
2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N,N-diphenylbutanamide (PubChem CID 23859713) has the molecular formula C31H26N4OS and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N,N-diphenylbutanamide.
| Compound Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N,N-diphenylbutanamide |
|---|---|
| PubChem CID | 23859713 |
| Molecular Formula | C31H26N4OS |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N,N-diphenylbutanamide |
| SMILES | CCC(Sc1nnc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H26N4OS/c1-2-27(30(36)35(25-19-11-5-12-20-25)26-21-13-6-14-22-26)37-31-32-28(23-15-7-3-8-16-23)29(33-34-31)24-17-9-4-10-18-24/h3-22,27H,2H2,1H3 |
| InChIKey | QTVZJONQOCVBAB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |